| Ident. | Authors (with country if any) | Title |
|---|
| 000288 |
| Effect of La3+ substitution on the phase transitions, microstructure and electrical properties of Bi1-xLaxFeO3 ceramics |
| 000305 |
| Construction of two novel indium phosphites with (3,6)- and (3,5)-connected frameworks: Synthesis, structure and characterization |
| 000707 |
| Structural characteristics of Mg-doped (I-x)(K0.5Na0.5)NbO3-xLiSbO3 lead-free ceramics as revealed by Raman spectroscopy |
| 000A35 |
| Structure distortion and magnetism in double perovskites Ca2-xLaxFeReO6 ( 0 < x ≤ 0.8) |
| 000A59 |
| Pulsed electrodeposition of oxygen-free tin monosulfide thin films using lactic acid/sodium lactate buffered electrolytes |
| 000C69 |
| Transport and magnetoresistance in double-doped La(2+x)/3Sr(1-x)/3FexMn1-xO3 films |
| 000D28 |
| Structure and optical properties of SnS thin film prepared by pulse electrodeposition |
| 000D97 |
| New indium selenite-oxalate and indium oxalate with two-and three-dimensional structures |
| 000E89 |
| Electronic and optical properties of orthorhombic LiInS2 and LiInSe2: A density functional theory investigation |
| 000F75 |
| A 3D porous indium(III) coordination polymer involving in-situ ligand synthesis |
| 001124 |
| Hydrothermal Synthesis and Crystal Structure of Polar and Nonpolar Compounds in Indium Iodate Family |
| 001279 |
| Synthesis, structure and fluorescence properties of a highly stable indium(III)-2,5-pyridinedicarboxylate coordination polymer |
| 001526 |
| Synthesis, characterization, and photocatalytic properties of InVO4 nanoparticles |
| 001625 |
| Formation and performances of porous InVO4 films |
| 001679 |
| Characterization of SnS films prepared by constant-current electro-deposition |
| 001C15 |
| Electric-field-induced strain and piezoelectric properties of a high Curie temperature Pb(In1/2Nb1/2)O3-PbTiO3single crystal |
