| Ident. | Authors (with country if any) | Title |
|---|
| 000037 |
| Controllable synthesis of plasmonic ZnO/Au core/shell nanocable arrays on ITO glass |
| 000047 |
| A facile in situ fabrication and visible-light-response photocatalytic properties of porous carbon sphere/InOOH nanocomposites |
| 000057 |
| Ultrasensitive electrochemiluminescence immunoassay for tumor marker based on quantum dots coated carbon nanospheres |
| 000115 |
| Self-assembled synthesis of TiO2/TiB2 nanowall and its photocatalytic properties |
| 000116 |
| Seed-mediated direct growth of CdSe nanoclusters on substrates |
| 000132 |
| Preparation of a hybrid polymer solar cell based on MEH-PPV/ZnO nanorods : Solar Energy Generation and Energy Storage |
| 000136 |
| Preparation and photovoltaic properties of the composite based on CdS nanorod arrays and PCPDTBSe |
| 000187 |
| Less contribution of nonradiative recombination in ZnO nails compared with rods |
| 000218 |
| In(OH)3 and In2O3 nanorice and microflowers: morphology transformation and optical properties |
| 000246 |
| Graphene quantum dots-incorporated cathode buffer for improvement of inverted polymer solar cells |
| 000283 |
| Effect of ion doping in different sites on the morphology and photocatalytic activity of BiFeO3 microcrystals |
| 000303 |
| Controllable preparation of WO3 nanorod arrays by hydrothermal method |
| 000305 |
| Construction of two novel indium phosphites with (3,6)- and (3,5)-connected frameworks: Synthesis, structure and characterization |
| 000331 |
| A series of novel gallium and indium borates constructed from [B5O8(OH)2]3- clusters and metal complex linkers |
| 000363 |
| Three-Dimensional Pillared-Layer 3d-4f Heterometallic Coordination Polymers With or Without Halides |
| 000450 |
| Particle Size and Structural Control of ZnWO4 Nanocrystals via Sn2+ Doping for Tunable Optical and Visible Photocatalytic Properties |
| 000487 |
| Integrated ZnO nanotube arrays as efficient dye-sensitized solar cells |
| 000503 |
| Hydrothermal synthesis of Cu2S nanocrystalline thin film on indium tin oxide substrate: Morphology, optical and electrical properties |
| 000504 |
| Hydrothermal synthesis and photoelectrochemical properties of In2S3 thin films with a wedgelike structure |
| 000538 |
| Explorations of new selenites of the group IIIA and IVA metals |
| 000547 |
| Enhanced ethanol sensing properties based on α-Fe2O3/In2O3 hollow microspheres |
| 000612 |
| Biomolecule-assisted synthesis and gas-sensing properties of porous nanosheet-based corundum In2O3 microflowers |
| 000649 |
| Well-aligned ZnO nanorod arrays from diameter-controlled growth and their application in inverted polymer solar cell |
| 000700 |
| Syntheses, Characterization, and Properties of Three-Dimensional Pillared Frameworks with Entanglement |
| 000752 |
| Performance of polymer/ZnO hybrid photovoltaic devices determined by reaction time for oriented ZnO nanorod growth |
| 000780 |
| Microwave-assisted hydrothermal synthesis of transition-metal doped ZnIn2S4 and its photocatalytic activity for hydrogen evolution under visible light |
| 000800 |
| Investigation on Indium-Filled Skutterudite Materials Prepared by Combining Hydrothermal Synthesis and Hot Pressing |
| 000826 |
| Hydrothermal synthesis of well-stable silver nanoparticles and their application for enzymeless hydrogen peroxide detection |
| 000A34 |
| Studies on the PEG-Assisted Hydrothermal Synthesis and Growth Mechanism of ZnO Microrod and Mesoporous Microsphere Arrays on the Substrate |
| 000A46 |
| Single-Crystalline Semiconductor In(OH)3 Nanocubes with Bifunctions: Superhydrophobicity and Photocatalytic Activity |
| 000A62 |
| Preparation of ZnIn2S4/fluoropolymer fiber composites and its photocatalytic H2 evolution from splitting of water using Xe lamp irradiation |
| 000A91 |
| Microwave hydrothermal synthesis and photocatalytic activity of AgIn5S8 for the degradation of dye |
| 000B01 |
| Linear field emission cathode with ZnO grown in aqueous solutions |
| 000B51 |
| Facile synthesis of SnO2 nanograss array films by hydrothermal method |
| 000B71 |
| Electrowetting on ZnO nanowires |
| 000D63 |
| Preparation and electrochemical properties of indium- and sulfur-doped LiMnO2 with orthorhombic structure as cathode materials |
| 000D97 |
| New indium selenite-oxalate and indium oxalate with two-and three-dimensional structures |
| 000E38 |
| Hydrothermal Syntheses and Structural Diversity of Cobalt Complexes with 2,2'-Bibenzimidazole Ligand by Temperature Tuning Strategy |
| 000F75 |
| A 3D porous indium(III) coordination polymer involving in-situ ligand synthesis |
| 001053 |
| Preparation of porous CdIn2S4 photocatalyst films by hydrothermal crystal growth at solid/liquid/gas interfaces |
| 001080 |
| One-Step Aqueous Solvothermal Synthesis of In2O3Nanocrystals |
| 001124 |
| Hydrothermal Synthesis and Crystal Structure of Polar and Nonpolar Compounds in Indium Iodate Family |
| 001241 |
| A complexant-assisted hydrothermal procedure for growing well-dispersed InP nanocrystals |
| 001248 |
| (2,2'-bipy)[In2(OH)2(H2O)](SO4)2 : The first indium sulfate with a layer structure |
| 001279 |
| Synthesis, structure and fluorescence properties of a highly stable indium(III)-2,5-pyridinedicarboxylate coordination polymer |
| 001414 |
| Energy transfer and heat-treatment effect of photoluminescence in Eu3+ -doped TbPO4 nanowires |
| 001612 |
| Hydrothermal synthesis and crystal structures of two NLO compounds, NaIO3.H2O and In(IO3)3 |
| 001688 |
| Anisotropic growth of In(OH)3 nanocubes to nanorods and nanosheets via a solution-based seed method |
| 001690 |
| An indium(III)-water chain based on an unusual acyclic water pentamer |
| 001694 |
| 3-D indium(III)-btc channel frameworks and their ion-exchange properties (btc = 1,3,5-benzenetricarboxylate) |
| 001740 |
| Size-controllable growth of Single crystal In(OH)3 and In2O3 nanocubes |
| 001752 |
| Preparation of monodispersed tin-doped indium oxide powders by hydrothermal method |
| 001803 |
| Hydrothermal synthesis of porous FeIn2S4 microspheres and their electrochemical properties |
| 001854 |
| An open-framework three-dimensional indium oxalate : [In(OH)(C2O4)(H2O)]3 H2O |
| 001929 |
| The first indium-organic two-dimensional layer network with rhombus grids |
| 001A00 |
| Hydrothermal synthesis of single crystalline In(OH)3 nanorods and their characterization |
| 001A01 |
| Hydrothermal synthesis and characterization of two new three-dimensional fluoroindium phosphates In4(PO4)4(H2O)4F2.C6H14N2 and In8(P04)8(H2O)8F4. (C5H14N2)2 |
| 001B44 |
| Structure change near the magnetic-transition temperature in the perovskite compound Ba(In0.5Sb0.5)03 |
| 001B93 |
| Hydrothermal synthesis and characterization of CuIn2.0Se3.5 nanocrystallites |
| 001B94 |
| Hydrothermal synthesis and characterization of AgInSe2 nanorods |
| 001D66 |
| Hydrothermal synthesis and crystal structure of the first ammonium indium(III) phosphate NH4In(OH)PO4 with spiral chains of InO4(OH)2 |
| 001E89 |
| Synthesis and characterization of ternary CuInS2 nanorods via a hydrothermal route |
| 001F38 |
| Hydrothermal synthesis and crystal structure of Na2In2[PO3(OH)]4.H2O with a new structure type |
| 002077 |
| Preparation and characterization of indium films by electroless plating under hydrothermal conditions |
| 002395 |
| Hydrothermal synthesis and characterization of perovskite-type Ba2SbMO6 (M = In, Y, Nd) oxides |
| 002431 |
| A metal-rich fluorinated indium phosphate, 4[NH3(CH2)3NH3]-3[H3O]-[In9(PO4)6(HPO4)2F16]-3H2O, with 14-membered ring channels |
